C16H23N3S — CID 106620444
N-butyl-N-(pyrrolidin-2-ylmethyl)-2,1-benzothiazol-3-amine (PubChem CID 106620444) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is N-butyl-N-(pyrrolidin-2-ylmethyl)-2,1-benzothiazol-3-amine.
| Compound Name | N-butyl-N-(pyrrolidin-2-ylmethyl)-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 106620444 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-butyl-N-(pyrrolidin-2-ylmethyl)-2,1-benzothiazol-3-amine |
| SMILES | CCCCN(CC1CCCN1)c1snc2ccccc12 |
| InChI | InChI=1S/C16H23N3S/c1-2-3-11-19(12-13-7-6-10-17-13)16-14-8-4-5-9-15(14)18-20-16/h4-5,8-9,13,17H,2-3,6-7,10-12H2,1H3 |
| InChIKey | WZCNRXUAOYEVFR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |