C14H23ClN4O2 — CID 106621465
4-chloro-5-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-2-propylpyridazin-3-one (PubChem CID 106621465) has the molecular formula C14H23ClN4O2 and a molecular weight of 314.82 g/mol. Its IUPAC name is 4-chloro-5-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-2-propylpyridazin-3-one.
| Compound Name | 4-chloro-5-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-2-propylpyridazin-3-one |
|---|---|
| PubChem CID | 106621465 |
| Molecular Formula | C14H23ClN4O2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-chloro-5-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-2-propylpyridazin-3-one |
| SMILES | CCCn1ncc(N(CCO)CC2CCCN2)c(Cl)c1=O |
| InChI | InChI=1S/C14H23ClN4O2/c1-2-6-19-14(21)13(15)12(9-17-19)18(7-8-20)10-11-4-3-5-16-11/h9,11,16,20H,2-8,10H2,1H3 |
| InChIKey | SXSBYSBFKSYWKU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |