C14H26O5Si — CID 10662148
(3R,4S,5S)-4-methoxy-3-(methoxymethoxy)-5-methyl-2-(2-trimethylsilylethynyl)oxan-2-ol (PubChem CID 10662148) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is (3R,4S,5S)-4-methoxy-3-(methoxymethoxy)-5-methyl-2-(2-trimethylsilylethynyl)oxan-2-ol.
| Compound Name | (3R,4S,5S)-4-methoxy-3-(methoxymethoxy)-5-methyl-2-(2-trimethylsilylethynyl)oxan-2-ol |
|---|---|
| PubChem CID | 10662148 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (3R,4S,5S)-4-methoxy-3-(methoxymethoxy)-5-methyl-2-(2-trimethylsilylethynyl)oxan-2-ol |
| SMILES | COCO[C@@H]1[C@@H](OC)[C@@H](C)COC1(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C14H26O5Si/c1-11-9-19-14(15,7-8-20(4,5)6)13(12(11)17-3)18-10-16-2/h11-13,15H,9-10H2,1-6H3/t11-,12-,13+,14?/m0/s1 |
| InChIKey | WFBKHWHSMKOPIB-ICIURTGMSA-N |
| XLogP | 1.23 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|