C17H28N2O2 — CID 106622226
2-[1-[piperidin-2-ylmethyl(propan-2-yl)amino]ethyl]benzene-1,4-diol (PubChem CID 106622226) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-[1-[piperidin-2-ylmethyl(propan-2-yl)amino]ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-[piperidin-2-ylmethyl(propan-2-yl)amino]ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 106622226 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2-[1-[piperidin-2-ylmethyl(propan-2-yl)amino]ethyl]benzene-1,4-diol |
| SMILES | CC(C)N(CC1CCCCN1)C(C)c1cc(O)ccc1O |
| InChI | InChI=1S/C17H28N2O2/c1-12(2)19(11-14-6-4-5-9-18-14)13(3)16-10-15(20)7-8-17(16)21/h7-8,10,12-14,18,20-21H,4-6,9,11H2,1-3H3 |
| InChIKey | YNDWCFBROFDABT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|