C12H14F6O2 — CID 10662252
[1-(1,1,2,3,3,3-hexafluoropropyl)cyclopentyl] 2-methylprop-2-enoate (PubChem CID 10662252) has the molecular formula C12H14F6O2 and a molecular weight of 304.23 g/mol. Its IUPAC name is [1-(1,1,2,3,3,3-hexafluoropropyl)cyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [1-(1,1,2,3,3,3-hexafluoropropyl)cyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 10662252 |
| Molecular Formula | C12H14F6O2 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [1-(1,1,2,3,3,3-hexafluoropropyl)cyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C(F)(F)C(F)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C12H14F6O2/c1-7(2)8(19)20-10(5-3-4-6-10)11(14,15)9(13)12(16,17)18/h9H,1,3-6H2,2H3 |
| InChIKey | QDYDVWJMKYOGDE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|