About N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide
N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide (PubChem CID 10662458) has the molecular formula C18H30N2O2
and a molecular weight of 306.45 g/mol. Its IUPAC name is N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide.
Molecular Properties
| Compound Name | N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide |
| PubChem CID | 10662458 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide |
| SMILES | CC(C)C(=O)N1CCCC(C)(C)C1C(=O)NC1=CCCCC1 |
| InChI | InChI=1S/C18H30N2O2/c1-13(2)17(22)20-12-8-11-18(3,4)15(20)16(21)19-14-9-6-5-7-10-14/h9,13,15H,5-8,10-12H2,1-4H3,(H,19,21) |
| InChIKey | HZDSOAKDJKCOLT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide?
The IUPAC name of N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide (CID 10662458) is N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide.
What is the SMILES notation for N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide?
The canonical SMILES for N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide is CC(C)C(=O)N1CCCC(C)(C)C1C(=O)NC1=CCCCC1.
What is the InChIKey of N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide?
The InChIKey is HZDSOAKDJKCOLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O2/c1-13(2)17(22)20-12-8-11-18(3,4)15(20)16(21)19-14-9-6-5-7-10-14/h9,13,15H,5-8,10-12H2,1-4H3,(H,19,21).
What are the key properties of N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide?
N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide has a molecular weight of 306.45 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexen-1-yl)-3,3-dimethyl-1-(2-methylpropanoyl)piperidine-2-carboxamide is sourced from PubChem (CID 10662458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).