C20H21NO2 — CID 10662521
(3S,3aR,6R,6aS)-3,6-diphenyl-6a-prop-2-enyl-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole (PubChem CID 10662521) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3S,3aR,6R,6aS)-3,6-diphenyl-6a-prop-2-enyl-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole.
| Compound Name | (3S,3aR,6R,6aS)-3,6-diphenyl-6a-prop-2-enyl-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 10662521 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3S,3aR,6R,6aS)-3,6-diphenyl-6a-prop-2-enyl-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole |
| SMILES | C=CC[C@]12NO[C@H](c3ccccc3)[C@H]1CO[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C20H21NO2/c1-2-13-20-17(14-22-19(20)16-11-7-4-8-12-16)18(23-21-20)15-9-5-3-6-10-15/h2-12,17-19,21H,1,13-14H2/t17-,18-,19-,20+/m1/s1 |
| InChIKey | BRMUVPIZYVQHFI-WTGUMLROSA-N |
| XLogP | 3.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|