C15H20F2N2O — CID 106626235
N-ethyl-2,6-difluoro-N-(piperidin-2-ylmethyl)benzamide (PubChem CID 106626235) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is N-ethyl-2,6-difluoro-N-(piperidin-2-ylmethyl)benzamide.
| Compound Name | N-ethyl-2,6-difluoro-N-(piperidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106626235 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-ethyl-2,6-difluoro-N-(piperidin-2-ylmethyl)benzamide |
| SMILES | CCN(CC1CCCCN1)C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C15H20F2N2O/c1-2-19(10-11-6-3-4-9-18-11)15(20)14-12(16)7-5-8-13(14)17/h5,7-8,11,18H,2-4,6,9-10H2,1H3 |
| InChIKey | XXXNZVRIHCYMJN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |