C15H21N3O — CID 106627024
N-cyclopropyl-N-(piperidin-2-ylmethyl)pyridine-2-carboxamide (PubChem CID 106627024) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N-cyclopropyl-N-(piperidin-2-ylmethyl)pyridine-2-carboxamide.
| Compound Name | N-cyclopropyl-N-(piperidin-2-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106627024 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-cyclopropyl-N-(piperidin-2-ylmethyl)pyridine-2-carboxamide |
| SMILES | O=C(c1ccccn1)N(CC1CCCCN1)C1CC1 |
| InChI | InChI=1S/C15H21N3O/c19-15(14-6-2-4-10-17-14)18(13-7-8-13)11-12-5-1-3-9-16-12/h2,4,6,10,12-13,16H,1,3,5,7-9,11H2 |
| InChIKey | XPIIBDZBVAUHAZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |