C16H22O4S — CID 10662749
(1S,4S,5R)-2,2-diethoxy-4-[(S)-(4-methylphenyl)sulfinyl]-6-oxabicyclo[3.1.0]hexane (PubChem CID 10662749) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is (1S,4S,5R)-2,2-diethoxy-4-[(S)-(4-methylphenyl)sulfinyl]-6-oxabicyclo[3.1.0]hexane.
| Compound Name | (1S,4S,5R)-2,2-diethoxy-4-[(S)-(4-methylphenyl)sulfinyl]-6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 10662749 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (1S,4S,5R)-2,2-diethoxy-4-[(S)-(4-methylphenyl)sulfinyl]-6-oxabicyclo[3.1.0]hexane |
| SMILES | CCOC1(OCC)C[C@H]([S@](=O)c2ccc(C)cc2)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C16H22O4S/c1-4-18-16(19-5-2)10-13(14-15(16)20-14)21(17)12-8-6-11(3)7-9-12/h6-9,13-15H,4-5,10H2,1-3H3/t13-,14-,15-,21+/m0/s1 |
| InChIKey | BYWZUEAHXWYOEY-BOLFOIPXSA-N |
| XLogP | 2.41 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|