C13H24N2O — CID 106627593
(Z)-N,2-dimethyl-N-(piperidin-3-ylmethyl)pent-2-enamide (PubChem CID 106627593) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (Z)-N,2-dimethyl-N-(piperidin-3-ylmethyl)pent-2-enamide.
| Compound Name | (Z)-N,2-dimethyl-N-(piperidin-3-ylmethyl)pent-2-enamide |
|---|---|
| PubChem CID | 106627593 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (Z)-N,2-dimethyl-N-(piperidin-3-ylmethyl)pent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)N(C)CC1CCCNC1 |
| InChI | InChI=1S/C13H24N2O/c1-4-6-11(2)13(16)15(3)10-12-7-5-8-14-9-12/h6,12,14H,4-5,7-10H2,1-3H3/b11-6- |
| InChIKey | TVPSNSUTSKYSEQ-WDZFZDKYSA-N |
| XLogP | 1.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|