About 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline
9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline (PubChem CID 10662788) has the molecular formula C11H10IN3
and a molecular weight of 311.13 g/mol. Its IUPAC name is 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline.
Molecular Properties
| Compound Name | 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline |
| PubChem CID | 10662788 |
| Molecular Formula | C11H10IN3 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline |
| SMILES | CC1=Nc2ccc(I)cc2C2=NCCN12 |
| InChI | InChI=1S/C11H10IN3/c1-7-14-10-3-2-8(12)6-9(10)11-13-4-5-15(7)11/h2-3,6H,4-5H2,1H3 |
| InChIKey | KWHQOGPDONBFME-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline?
The IUPAC name of 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline (CID 10662788) is 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline.
What is the SMILES notation for 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline?
The canonical SMILES for 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline is CC1=Nc2ccc(I)cc2C2=NCCN12.
What is the InChIKey of 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline?
The InChIKey is KWHQOGPDONBFME-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10IN3/c1-7-14-10-3-2-8(12)6-9(10)11-13-4-5-15(7)11/h2-3,6H,4-5H2,1H3.
What are the key properties of 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline?
9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline has a molecular weight of 311.13 g/mol, XLogP of 2.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-iodo-5-methyl-2,3-dihydroimidazo[1,2-c]quinazoline is sourced from PubChem (CID 10662788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).