C15H21FN2O — CID 106628063
2-fluoro-N,5-dimethyl-N-(piperidin-3-ylmethyl)benzamide (PubChem CID 106628063) has the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. Its IUPAC name is 2-fluoro-N,5-dimethyl-N-(piperidin-3-ylmethyl)benzamide.
| Compound Name | 2-fluoro-N,5-dimethyl-N-(piperidin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106628063 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-fluoro-N,5-dimethyl-N-(piperidin-3-ylmethyl)benzamide |
| SMILES | Cc1ccc(F)c(C(=O)N(C)CC2CCCNC2)c1 |
| InChI | InChI=1S/C15H21FN2O/c1-11-5-6-14(16)13(8-11)15(19)18(2)10-12-4-3-7-17-9-12/h5-6,8,12,17H,3-4,7,9-10H2,1-2H3 |
| InChIKey | DKVKNGVZWFHWKP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |