C16H24N2O3 — CID 106628169
2,3-dihydroxy-N-(piperidin-3-ylmethyl)-N-propylbenzamide (PubChem CID 106628169) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(piperidin-3-ylmethyl)-N-propylbenzamide.
| Compound Name | 2,3-dihydroxy-N-(piperidin-3-ylmethyl)-N-propylbenzamide |
|---|---|
| PubChem CID | 106628169 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2,3-dihydroxy-N-(piperidin-3-ylmethyl)-N-propylbenzamide |
| SMILES | CCCN(CC1CCCNC1)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C16H24N2O3/c1-2-9-18(11-12-5-4-8-17-10-12)16(21)13-6-3-7-14(19)15(13)20/h3,6-7,12,17,19-20H,2,4-5,8-11H2,1H3 |
| InChIKey | FOAWYVMRESCTHM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|