About (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium
(Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium (PubChem CID 10662874) has the molecular formula C11H7F6N2O2+
and a molecular weight of 313.18 g/mol. Its IUPAC name is (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium.
Molecular Properties
| Compound Name | (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium |
| PubChem CID | 10662874 |
| Molecular Formula | C11H7F6N2O2+ |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium |
| SMILES | CO/C(O)=C(\[N+]#N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H6F6N2O2/c1-21-9(20)8(19-18)5-2-6(10(12,13)14)4-7(3-5)11(15,16)17/h2-4H,1H3/p+1/b9-8- |
| InChIKey | POYGKULZOSUBSW-HJWRWDBZSA-O |
| XLogP | 4.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium?
The IUPAC name of (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium (CID 10662874) is (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium.
What is the SMILES notation for (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium?
The canonical SMILES for (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium is CO/C(O)=C(\[N+]#N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium?
The InChIKey is POYGKULZOSUBSW-HJWRWDBZSA-O. The full InChI is InChI=1S/C11H6F6N2O2/c1-21-9(20)8(19-18)5-2-6(10(12,13)14)4-7(3-5)11(15,16)17/h2-4H,1H3/p+1/b9-8-.
What are the key properties of (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium?
(Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium has a molecular weight of 313.18 g/mol, XLogP of 4.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-2-methoxyethenediazonium is sourced from PubChem (CID 10662874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).