C20H33N3 — CID 10663183
(5Z,8Z,11Z,14Z)-1-azidoicosa-5,8,11,14-tetraene (PubChem CID 10663183) has the molecular formula C20H33N3 and a molecular weight of 315.51 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-1-azidoicosa-5,8,11,14-tetraene.
| Compound Name | (5Z,8Z,11Z,14Z)-1-azidoicosa-5,8,11,14-tetraene |
|---|---|
| PubChem CID | 10663183 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.51 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-1-azidoicosa-5,8,11,14-tetraene |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCN=[N+]=[N-] |
| InChI | InChI=1S/C20H33N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-23-21/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-20H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | KWUWUHPXGBPGTG-DOFZRALJSA-N |
| XLogP | 7.44 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.51 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|