C14H23N3O3 — CID 106631949
N-[(5-nitrofuran-2-yl)methyl]-N-(piperidin-2-ylmethyl)propan-2-amine (PubChem CID 106631949) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[(5-nitrofuran-2-yl)methyl]-N-(piperidin-2-ylmethyl)propan-2-amine.
| Compound Name | N-[(5-nitrofuran-2-yl)methyl]-N-(piperidin-2-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 106631949 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-[(5-nitrofuran-2-yl)methyl]-N-(piperidin-2-ylmethyl)propan-2-amine |
| SMILES | CC(C)N(Cc1ccc([N+](=O)[O-])o1)CC1CCCCN1 |
| InChI | InChI=1S/C14H23N3O3/c1-11(2)16(9-12-5-3-4-8-15-12)10-13-6-7-14(20-13)17(18)19/h6-7,11-12,15H,3-5,8-10H2,1-2H3 |
| InChIKey | FGPHNTOSZDRJGJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|