C16H29ClN4 — CID 106632130
N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-N-(piperidin-2-ylmethyl)propan-2-amine (PubChem CID 106632130) has the molecular formula C16H29ClN4 and a molecular weight of 312.89 g/mol. Its IUPAC name is N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-N-(piperidin-2-ylmethyl)propan-2-amine.
| Compound Name | N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-N-(piperidin-2-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 106632130 |
| Molecular Formula | C16H29ClN4 |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-N-(piperidin-2-ylmethyl)propan-2-amine |
| SMILES | CCn1nc(C)c(Cl)c1CN(CC1CCCCN1)C(C)C |
| InChI | InChI=1S/C16H29ClN4/c1-5-21-15(16(17)13(4)19-21)11-20(12(2)3)10-14-8-6-7-9-18-14/h12,14,18H,5-11H2,1-4H3 |
| InChIKey | YIRPPWIYMPJQGH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |