C16H24BrClN2O — CID 106632604
2-(2-bromo-4-chlorophenoxy)-N-ethyl-N-(piperidin-2-ylmethyl)ethanamine (PubChem CID 106632604) has the molecular formula C16H24BrClN2O and a molecular weight of 375.74 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-N-ethyl-N-(piperidin-2-ylmethyl)ethanamine.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-N-ethyl-N-(piperidin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 106632604 |
| Molecular Formula | C16H24BrClN2O |
| Molecular Weight | 375.74 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-N-ethyl-N-(piperidin-2-ylmethyl)ethanamine |
| SMILES | CCN(CCOc1ccc(Cl)cc1Br)CC1CCCCN1 |
| InChI | InChI=1S/C16H24BrClN2O/c1-2-20(12-14-5-3-4-8-19-14)9-10-21-16-7-6-13(18)11-15(16)17/h6-7,11,14,19H,2-5,8-10,12H2,1H3 |
| InChIKey | HGMOQDGBIREUBB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.74 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |