C16H24IN3O — CID 106632733
2-[ethyl(piperidin-2-ylmethyl)amino]-N-(3-iodophenyl)acetamide (PubChem CID 106632733) has the molecular formula C16H24IN3O and a molecular weight of 401.29 g/mol. Its IUPAC name is 2-[ethyl(piperidin-2-ylmethyl)amino]-N-(3-iodophenyl)acetamide.
| Compound Name | 2-[ethyl(piperidin-2-ylmethyl)amino]-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 106632733 |
| Molecular Formula | C16H24IN3O |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-[ethyl(piperidin-2-ylmethyl)amino]-N-(3-iodophenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(I)c1)CC1CCCCN1 |
| InChI | InChI=1S/C16H24IN3O/c1-2-20(11-15-7-3-4-9-18-15)12-16(21)19-14-8-5-6-13(17)10-14/h5-6,8,10,15,18H,2-4,7,9,11-12H2,1H3,(H,19,21) |
| InChIKey | UYWWHDCDWBVQGQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|