C18H37N3O2 — CID 106632886
tert-butyl 2-[[3-(diethylamino)propylamino]methyl]piperidine-1-carboxylate (PubChem CID 106632886) has the molecular formula C18H37N3O2 and a molecular weight of 327.51 g/mol. Its IUPAC name is tert-butyl 2-[[3-(diethylamino)propylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[3-(diethylamino)propylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 106632886 |
| Molecular Formula | C18H37N3O2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | tert-butyl 2-[[3-(diethylamino)propylamino]methyl]piperidine-1-carboxylate |
| SMILES | CCN(CC)CCCNCC1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H37N3O2/c1-6-20(7-2)13-10-12-19-15-16-11-8-9-14-21(16)17(22)23-18(3,4)5/h16,19H,6-15H2,1-5H3 |
| InChIKey | MCCOINRBGIFCEM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|