C18H23NO4 — CID 10663296
(2S,3S,4S,5R)-2-[(1S,3S,4R)-2-benzyl-2-azabicyclo[2.2.1]hept-5-en-3-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 10663296) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-[(1S,3S,4R)-2-benzyl-2-azabicyclo[2.2.1]hept-5-en-3-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-2-[(1S,3S,4R)-2-benzyl-2-azabicyclo[2.2.1]hept-5-en-3-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10663296 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (2S,3S,4S,5R)-2-[(1S,3S,4R)-2-benzyl-2-azabicyclo[2.2.1]hept-5-en-3-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H]([C@@H]2[C@H]3C=C[C@H](C3)N2Cc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H23NO4/c20-10-14-16(21)17(22)18(23-14)15-12-6-7-13(8-12)19(15)9-11-4-2-1-3-5-11/h1-7,12-18,20-22H,8-10H2/t12-,13+,14+,15-,16+,17-,18-/m0/s1 |
| InChIKey | VCSWKYGVCICBAA-FXVDGXSLSA-N |
| XLogP | 0.30 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|