About 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one
5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one (PubChem CID 10663303) has the molecular formula C17H23N3O3
and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one |
| PubChem CID | 10663303 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one |
| SMILES | CCCCCCCCc1c(-c2cccc([N+](=O)[O-])c2)[nH][nH]c1=O |
| InChI | InChI=1S/C17H23N3O3/c1-2-3-4-5-6-7-11-15-16(18-19-17(15)21)13-9-8-10-14(12-13)20(22)23/h8-10,12H,2-7,11H2,1H3,(H2,18,19,21) |
| InChIKey | MXLOTTSSFYYHMP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one (CID 10663303) is 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one is CCCCCCCCc1c(-c2cccc([N+](=O)[O-])c2)[nH][nH]c1=O.
What is the InChIKey of 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one?
The InChIKey is MXLOTTSSFYYHMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O3/c1-2-3-4-5-6-7-11-15-16(18-19-17(15)21)13-9-8-10-14(12-13)20(22)23/h8-10,12H,2-7,11H2,1H3,(H2,18,19,21).
What are the key properties of 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one?
5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one has a molecular weight of 317.39 g/mol, XLogP of 4.18, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-nitrophenyl)-4-octyl-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 10663303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).