C16H26N2O — CID 106633639
3-(2-methylpropoxy)-N-(piperidin-2-ylmethyl)aniline (PubChem CID 106633639) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 3-(2-methylpropoxy)-N-(piperidin-2-ylmethyl)aniline.
| Compound Name | 3-(2-methylpropoxy)-N-(piperidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 106633639 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 3-(2-methylpropoxy)-N-(piperidin-2-ylmethyl)aniline |
| SMILES | CC(C)COc1cccc(NCC2CCCCN2)c1 |
| InChI | InChI=1S/C16H26N2O/c1-13(2)12-19-16-8-5-7-14(10-16)18-11-15-6-3-4-9-17-15/h5,7-8,10,13,15,17-18H,3-4,6,9,11-12H2,1-2H3 |
| InChIKey | KESJDPJDTRVZNX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |