C14H24ClN3O — CID 106634560
2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-piperidin-2-ylethanol (PubChem CID 106634560) has the molecular formula C14H24ClN3O and a molecular weight of 285.82 g/mol. Its IUPAC name is 2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-piperidin-2-ylethanol.
| Compound Name | 2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-piperidin-2-ylethanol |
|---|---|
| PubChem CID | 106634560 |
| Molecular Formula | C14H24ClN3O |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-piperidin-2-ylethanol |
| SMILES | CCc1nn(CC)c(CC(O)C2CCCCN2)c1Cl |
| InChI | InChI=1S/C14H24ClN3O/c1-3-10-14(15)12(18(4-2)17-10)9-13(19)11-7-5-6-8-16-11/h11,13,16,19H,3-9H2,1-2H3 |
| InChIKey | LJEAEOSNLBFLON-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |