C11H19NO2 — CID 106634745
3,4-dihydro-2H-pyran-5-yl(piperidin-2-yl)methanol (PubChem CID 106634745) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-5-yl(piperidin-2-yl)methanol.
| Compound Name | 3,4-dihydro-2H-pyran-5-yl(piperidin-2-yl)methanol |
|---|---|
| PubChem CID | 106634745 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 3,4-dihydro-2H-pyran-5-yl(piperidin-2-yl)methanol |
| SMILES | OC(C1=COCCC1)C1CCCCN1 |
| InChI | InChI=1S/C11H19NO2/c13-11(9-4-3-7-14-8-9)10-5-1-2-6-12-10/h8,10-13H,1-7H2 |
| InChIKey | FWVAZDLHPDTFIN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |