C15H16N2O4S — CID 10663488
hydrogen sulfate;9-methyl-2-aza-9-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene (PubChem CID 10663488) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is hydrogen sulfate;9-methyl-2-aza-9-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene.
| Compound Name | hydrogen sulfate;9-methyl-2-aza-9-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene |
|---|---|
| PubChem CID | 10663488 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | hydrogen sulfate;9-methyl-2-aza-9-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene |
| SMILES | C[N+]1=CC2C=CC=C3N=CC4=CC=CC1C4C32.O=S(=O)([O-])O |
| InChI | InChI=1S/C15H15N2.H2O4S/c1-17-9-11-5-2-6-12-14(11)15-10(8-16-12)4-3-7-13(15)17;1-5(2,3)4/h2-9,11,13-15H,1H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | XAPYORMEIRHSNM-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 92.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|