About 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid
7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid (PubChem CID 10663547) has the molecular formula C12H21N2O5P
and a molecular weight of 304.28 g/mol. Its IUPAC name is 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid.
Molecular Properties
| Compound Name | 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid |
| PubChem CID | 10663547 |
| Molecular Formula | C12H21N2O5P |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid |
| SMILES | Cc1cn(CCCCCCCP(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H21N2O5P/c1-10-9-14(12(16)13-11(10)15)7-5-3-2-4-6-8-20(17,18)19/h9H,2-8H2,1H3,(H,13,15,16)(H2,17,18,19) |
| InChIKey | QIFYPUZLUKPFTI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid?
The IUPAC name of 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid (CID 10663547) is 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid.
What is the SMILES notation for 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid?
The canonical SMILES for 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid is Cc1cn(CCCCCCCP(=O)(O)O)c(=O)[nH]c1=O.
What is the InChIKey of 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid?
The InChIKey is QIFYPUZLUKPFTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N2O5P/c1-10-9-14(12(16)13-11(10)15)7-5-3-2-4-6-8-20(17,18)19/h9H,2-8H2,1H3,(H,13,15,16)(H2,17,18,19).
What are the key properties of 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid?
7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid has a molecular weight of 304.28 g/mol, XLogP of 0.97, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(5-methyl-2,4-dioxopyrimidin-1-yl)heptylphosphonic acid is sourced from PubChem (CID 10663547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).