C15H19N3O3S — CID 10663568
2-[5-(4-methoxyphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]ethyl 2-methylpropanoate (PubChem CID 10663568) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-[5-(4-methoxyphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]ethyl 2-methylpropanoate.
| Compound Name | 2-[5-(4-methoxyphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 10663568 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-[5-(4-methoxyphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]ethyl 2-methylpropanoate |
| SMILES | COc1ccc(-c2nc(=S)n(CCOC(=O)C(C)C)[nH]2)cc1 |
| InChI | InChI=1S/C15H19N3O3S/c1-10(2)14(19)21-9-8-18-15(22)16-13(17-18)11-4-6-12(20-3)7-5-11/h4-7,10H,8-9H2,1-3H3,(H,16,17,22) |
| InChIKey | OHIGYPGREHZLKM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|