About benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate
benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate (PubChem CID 10663572) has the molecular formula C21H23NO2
and a molecular weight of 321.42 g/mol. Its IUPAC name is benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate |
| PubChem CID | 10663572 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate |
| SMILES | CCN1CC=C(c2ccccc2)C(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H23NO2/c1-2-22-14-13-19(18-11-7-4-8-12-18)20(15-22)21(23)24-16-17-9-5-3-6-10-17/h3-13,20H,2,14-16H2,1H3 |
| InChIKey | USWIIRIGMDFSNJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate?
The IUPAC name of benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate (CID 10663572) is benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate.
What is the SMILES notation for benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate?
The canonical SMILES for benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate is CCN1CC=C(c2ccccc2)C(C(=O)OCc2ccccc2)C1.
What is the InChIKey of benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate?
The InChIKey is USWIIRIGMDFSNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO2/c1-2-22-14-13-19(18-11-7-4-8-12-18)20(15-22)21(23)24-16-17-9-5-3-6-10-17/h3-13,20H,2,14-16H2,1H3.
What are the key properties of benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate?
benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate has a molecular weight of 321.42 g/mol, XLogP of 3.77, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-3-carboxylate is sourced from PubChem (CID 10663572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).