C17H27N3O3 — CID 106637826
tert-butyl 2-[[(2-methoxy-3-pyridinyl)methylamino]methyl]pyrrolidine-1-carboxylate (PubChem CID 106637826) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl 2-[[(2-methoxy-3-pyridinyl)methylamino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(2-methoxy-3-pyridinyl)methylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 106637826 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | tert-butyl 2-[[(2-methoxy-3-pyridinyl)methylamino]methyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ncccc1CNCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27N3O3/c1-17(2,3)23-16(21)20-10-6-8-14(20)12-18-11-13-7-5-9-19-15(13)22-4/h5,7,9,14,18H,6,8,10-12H2,1-4H3 |
| InChIKey | VUMUXPLJGBOLMU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |