C17H19N5O2 — CID 10663820
ethyl 4-(2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperazine-1-carboxylate (PubChem CID 10663820) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is ethyl 4-(2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10663820 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | ethyl 4-(2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nc3cccnc3n3cccc23)CC1 |
| InChI | InChI=1S/C17H19N5O2/c1-2-24-17(23)21-11-9-20(10-12-21)16-14-6-4-8-22(14)15-13(19-16)5-3-7-18-15/h3-8H,2,9-12H2,1H3 |
| InChIKey | URLYEVZCOFLWKV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |