C15H20O8 — CID 10664008
dimethyl (1S,4R,5S)-4,7,7-trimethoxy-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate (PubChem CID 10664008) has the molecular formula C15H20O8 and a molecular weight of 328.32 g/mol. Its IUPAC name is dimethyl (1S,4R,5S)-4,7,7-trimethoxy-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate.
| Compound Name | dimethyl (1S,4R,5S)-4,7,7-trimethoxy-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 10664008 |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | dimethyl (1S,4R,5S)-4,7,7-trimethoxy-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate |
| SMILES | COC(=O)C1=C[C@]2(OC)C(=O)C(OC)(OC)[C@H]1C[C@@H]2C(=O)OC |
| InChI | InChI=1S/C15H20O8/c1-19-11(16)8-7-14(21-3)10(12(17)20-2)6-9(8)15(22-4,23-5)13(14)18/h7,9-10H,6H2,1-5H3/t9-,10+,14+/m0/s1 |
| InChIKey | LDTIAMLAUBRYJL-IMSIIYSGSA-N |
| XLogP | -0.15 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|