About 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine
8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine (PubChem CID 10664015) has the molecular formula C19H12N4O2
and a molecular weight of 328.33 g/mol. Its IUPAC name is 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine.
Molecular Properties
| Compound Name | 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine |
| PubChem CID | 10664015 |
| Molecular Formula | C19H12N4O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine |
| SMILES | O=[N+]([O-])c1cccc(-c2nc(-c3cccnc3)cc3cccnc23)c1 |
| InChI | InChI=1S/C19H12N4O2/c24-23(25)16-7-1-4-13(10-16)19-18-14(5-3-9-21-18)11-17(22-19)15-6-2-8-20-12-15/h1-12H |
| InChIKey | FSRCBTSVLQDXOV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine?
The IUPAC name of 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine (CID 10664015) is 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine.
What is the SMILES notation for 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine?
The canonical SMILES for 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine is O=[N+]([O-])c1cccc(-c2nc(-c3cccnc3)cc3cccnc23)c1.
What is the InChIKey of 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine?
The InChIKey is FSRCBTSVLQDXOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N4O2/c24-23(25)16-7-1-4-13(10-16)19-18-14(5-3-9-21-18)11-17(22-19)15-6-2-8-20-12-15/h1-12H.
What are the key properties of 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine?
8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine has a molecular weight of 328.33 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-nitrophenyl)-6-pyridin-3-yl-1,7-naphthyridine is sourced from PubChem (CID 10664015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).