About 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine
2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine (PubChem CID 106640398) has the molecular formula C10H16FNO
and a molecular weight of 185.24 g/mol. Its IUPAC name is 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine.
Molecular Properties
| Compound Name | 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine |
| PubChem CID | 106640398 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine |
| SMILES | FC(C1=CCCCO1)C1CCCN1 |
| InChI | InChI=1S/C10H16FNO/c11-10(8-4-3-6-12-8)9-5-1-2-7-13-9/h5,8,10,12H,1-4,6-7H2 |
| InChIKey | BIMYBDIRYFYEJY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine?
The IUPAC name of 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine (CID 106640398) is 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine.
What is the SMILES notation for 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine?
The canonical SMILES for 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine is FC(C1=CCCCO1)C1CCCN1.
What is the InChIKey of 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine?
The InChIKey is BIMYBDIRYFYEJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16FNO/c11-10(8-4-3-6-12-8)9-5-1-2-7-13-9/h5,8,10,12H,1-4,6-7H2.
What are the key properties of 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine?
2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine has a molecular weight of 185.24 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-dihydro-2H-pyran-6-yl(fluoro)methyl]pyrrolidine is sourced from PubChem (CID 106640398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).