C15H17FN2 — CID 106640483
2-(2-fluoro-2-pyrrolidin-2-ylethyl)quinoline (PubChem CID 106640483) has the molecular formula C15H17FN2 and a molecular weight of 244.31 g/mol. Its IUPAC name is 2-(2-fluoro-2-pyrrolidin-2-ylethyl)quinoline.
| Compound Name | 2-(2-fluoro-2-pyrrolidin-2-ylethyl)quinoline |
|---|---|
| PubChem CID | 106640483 |
| Molecular Formula | C15H17FN2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 2-(2-fluoro-2-pyrrolidin-2-ylethyl)quinoline |
| SMILES | FC(Cc1ccc2ccccc2n1)C1CCCN1 |
| InChI | InChI=1S/C15H17FN2/c16-13(15-6-3-9-17-15)10-12-8-7-11-4-1-2-5-14(11)18-12/h1-2,4-5,7-8,13,15,17H,3,6,9-10H2 |
| InChIKey | PJUFHYOMESKTQC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |