About 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole
5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole (PubChem CID 106640586) has the molecular formula C11H17ClFN3
and a molecular weight of 245.73 g/mol. Its IUPAC name is 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole |
| PubChem CID | 106640586 |
| Molecular Formula | C11H17ClFN3 |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(Cl)c1CC(F)C1CCCN1 |
| InChI | InChI=1S/C11H17ClFN3/c1-7-8(11(12)16(2)15-7)6-9(13)10-4-3-5-14-10/h9-10,14H,3-6H2,1-2H3 |
| InChIKey | NRISIBKHEUETHW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole?
The IUPAC name of 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole (CID 106640586) is 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole.
What is the SMILES notation for 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole?
The canonical SMILES for 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole is Cc1nn(C)c(Cl)c1CC(F)C1CCCN1.
What is the InChIKey of 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole?
The InChIKey is NRISIBKHEUETHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClFN3/c1-7-8(11(12)16(2)15-7)6-9(13)10-4-3-5-14-10/h9-10,14H,3-6H2,1-2H3.
What are the key properties of 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole?
5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole has a molecular weight of 245.73 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-(2-fluoro-2-pyrrolidin-2-ylethyl)-1,3-dimethylpyrazole is sourced from PubChem (CID 106640586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).