C15H28N4 — CID 106640781
N-[2-(2-methylpyrazol-3-yl)ethyl]-N-(piperidin-3-ylmethyl)propan-1-amine (PubChem CID 106640781) has the molecular formula C15H28N4 and a molecular weight of 264.42 g/mol. Its IUPAC name is N-[2-(2-methylpyrazol-3-yl)ethyl]-N-(piperidin-3-ylmethyl)propan-1-amine.
| Compound Name | N-[2-(2-methylpyrazol-3-yl)ethyl]-N-(piperidin-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 106640781 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | N-[2-(2-methylpyrazol-3-yl)ethyl]-N-(piperidin-3-ylmethyl)propan-1-amine |
| SMILES | CCCN(CCc1ccnn1C)CC1CCCNC1 |
| InChI | InChI=1S/C15H28N4/c1-3-10-19(13-14-5-4-8-16-12-14)11-7-15-6-9-17-18(15)2/h6,9,14,16H,3-5,7-8,10-13H2,1-2H3 |
| InChIKey | ZIZKDZOPVJZIIJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |