C13H19ClN4 — CID 106640995
5-chloro-N-cyclopropyl-N-(piperidin-2-ylmethyl)pyrimidin-2-amine (PubChem CID 106640995) has the molecular formula C13H19ClN4 and a molecular weight of 266.78 g/mol. Its IUPAC name is 5-chloro-N-cyclopropyl-N-(piperidin-2-ylmethyl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-cyclopropyl-N-(piperidin-2-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106640995 |
| Molecular Formula | C13H19ClN4 |
| Molecular Weight | 266.78 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 5-chloro-N-cyclopropyl-N-(piperidin-2-ylmethyl)pyrimidin-2-amine |
| SMILES | Clc1cnc(N(CC2CCCCN2)C2CC2)nc1 |
| InChI | InChI=1S/C13H19ClN4/c14-10-7-16-13(17-8-10)18(12-4-5-12)9-11-3-1-2-6-15-11/h7-8,11-12,15H,1-6,9H2 |
| InChIKey | ASHQNRAMKAKMHD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.78 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |