C13H21IN4 — CID 106642309
5-iodo-N-(piperidin-2-ylmethyl)-N-propylpyrimidin-4-amine (PubChem CID 106642309) has the molecular formula C13H21IN4 and a molecular weight of 360.24 g/mol. Its IUPAC name is 5-iodo-N-(piperidin-2-ylmethyl)-N-propylpyrimidin-4-amine.
| Compound Name | 5-iodo-N-(piperidin-2-ylmethyl)-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106642309 |
| Molecular Formula | C13H21IN4 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 5-iodo-N-(piperidin-2-ylmethyl)-N-propylpyrimidin-4-amine |
| SMILES | CCCN(CC1CCCCN1)c1ncncc1I |
| InChI | InChI=1S/C13H21IN4/c1-2-7-18(9-11-5-3-4-6-16-11)13-12(14)8-15-10-17-13/h8,10-11,16H,2-7,9H2,1H3 |
| InChIKey | MWAQPROVLKAEEO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|