C12H17BrClN3 — CID 106642794
5-bromo-3-chloro-N-methyl-N-(piperidin-3-ylmethyl)pyridin-2-amine (PubChem CID 106642794) has the molecular formula C12H17BrClN3 and a molecular weight of 318.65 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-methyl-N-(piperidin-3-ylmethyl)pyridin-2-amine.
| Compound Name | 5-bromo-3-chloro-N-methyl-N-(piperidin-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106642794 |
| Molecular Formula | C12H17BrClN3 |
| Molecular Weight | 318.65 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 5-bromo-3-chloro-N-methyl-N-(piperidin-3-ylmethyl)pyridin-2-amine |
| SMILES | CN(CC1CCCNC1)c1ncc(Br)cc1Cl |
| InChI | InChI=1S/C12H17BrClN3/c1-17(8-9-3-2-4-15-6-9)12-11(14)5-10(13)7-16-12/h5,7,9,15H,2-4,6,8H2,1H3 |
| InChIKey | CXELNDCALZMVQA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |