C20H28O4 — CID 10664328
(1R,5R,10S,11S)-5-hydroxy-3,4-di(propan-2-yloxy)tetracyclo[9.3.0.01,5.06,10]tetradeca-3,6-dien-2-one (PubChem CID 10664328) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1R,5R,10S,11S)-5-hydroxy-3,4-di(propan-2-yloxy)tetracyclo[9.3.0.01,5.06,10]tetradeca-3,6-dien-2-one.
| Compound Name | (1R,5R,10S,11S)-5-hydroxy-3,4-di(propan-2-yloxy)tetracyclo[9.3.0.01,5.06,10]tetradeca-3,6-dien-2-one |
|---|---|
| PubChem CID | 10664328 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1R,5R,10S,11S)-5-hydroxy-3,4-di(propan-2-yloxy)tetracyclo[9.3.0.01,5.06,10]tetradeca-3,6-dien-2-one |
| SMILES | CC(C)OC1=C(OC(C)C)[C@@]2(O)C3=CCC[C@H]3[C@@H]3CCC[C@@]32C1=O |
| InChI | InChI=1S/C20H28O4/c1-11(2)23-16-17(21)19-10-6-9-14(19)13-7-5-8-15(13)20(19,22)18(16)24-12(3)4/h8,11-14,22H,5-7,9-10H2,1-4H3/t13-,14-,19-,20-/m0/s1 |
| InChIKey | ZKOKWILVDWAPJG-FEBSWUBLSA-N |
| XLogP | 3.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|