C18H16F2O2S — CID 10664448
1,2-difluoro-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene (PubChem CID 10664448) has the molecular formula C18H16F2O2S and a molecular weight of 334.39 g/mol. Its IUPAC name is 1,2-difluoro-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene.
| Compound Name | 1,2-difluoro-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene |
|---|---|
| PubChem CID | 10664448 |
| Molecular Formula | C18H16F2O2S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1,2-difluoro-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccc(F)c(F)c3)CCC2)cc1 |
| InChI | InChI=1S/C18H16F2O2S/c1-23(21,22)14-8-5-12(6-9-14)15-3-2-4-16(15)13-7-10-17(19)18(20)11-13/h5-11H,2-4H2,1H3 |
| InChIKey | XIBHRRPDZXYFCM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|