C20H30O4 — CID 10664463
(3aS,3bR,6aR,7aS)-6a-ethyl-3b-hydroxy-7-methylidene-4,5-di(propan-2-yloxy)-2,3,3a,7a-tetrahydro-1H-cyclopenta[a]pentalen-6-one (PubChem CID 10664463) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (3aS,3bR,6aR,7aS)-6a-ethyl-3b-hydroxy-7-methylidene-4,5-di(propan-2-yloxy)-2,3,3a,7a-tetrahydro-1H-cyclopenta[a]pentalen-6-one.
| Compound Name | (3aS,3bR,6aR,7aS)-6a-ethyl-3b-hydroxy-7-methylidene-4,5-di(propan-2-yloxy)-2,3,3a,7a-tetrahydro-1H-cyclopenta[a]pentalen-6-one |
|---|---|
| PubChem CID | 10664463 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (3aS,3bR,6aR,7aS)-6a-ethyl-3b-hydroxy-7-methylidene-4,5-di(propan-2-yloxy)-2,3,3a,7a-tetrahydro-1H-cyclopenta[a]pentalen-6-one |
| SMILES | C=C1[C@H]2CCC[C@@H]2[C@]2(O)C(OC(C)C)=C(OC(C)C)C(=O)[C@]12CC |
| InChI | InChI=1S/C20H30O4/c1-7-19-13(6)14-9-8-10-15(14)20(19,22)18(24-12(4)5)16(17(19)21)23-11(2)3/h11-12,14-15,22H,6-10H2,1-5H3/t14-,15+,19+,20+/m1/s1 |
| InChIKey | BCJJMGBPWVJWFJ-QBTDHISASA-N |
| XLogP | 3.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|