C16H16BrF2N — CID 106645960
N-[(3-bromo-2-fluorophenyl)-(4-fluoro-2-methylphenyl)methyl]ethanamine (PubChem CID 106645960) has the molecular formula C16H16BrF2N and a molecular weight of 340.21 g/mol. Its IUPAC name is N-[(3-bromo-2-fluorophenyl)-(4-fluoro-2-methylphenyl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-2-fluorophenyl)-(4-fluoro-2-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106645960 |
| Molecular Formula | C16H16BrF2N |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-[(3-bromo-2-fluorophenyl)-(4-fluoro-2-methylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(F)cc1C)c1cccc(Br)c1F |
| InChI | InChI=1S/C16H16BrF2N/c1-3-20-16(12-8-7-11(18)9-10(12)2)13-5-4-6-14(17)15(13)19/h4-9,16,20H,3H2,1-2H3 |
| InChIKey | OZQVBQOCAVHWNB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |