C15H16BrFN2 — CID 106647594
1-(3-bromo-2-fluorophenyl)-N-methyl-3-pyridin-2-ylpropan-1-amine (PubChem CID 106647594) has the molecular formula C15H16BrFN2 and a molecular weight of 323.21 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)-N-methyl-3-pyridin-2-ylpropan-1-amine.
| Compound Name | 1-(3-bromo-2-fluorophenyl)-N-methyl-3-pyridin-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 106647594 |
| Molecular Formula | C15H16BrFN2 |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)-N-methyl-3-pyridin-2-ylpropan-1-amine |
| SMILES | CNC(CCc1ccccn1)c1cccc(Br)c1F |
| InChI | InChI=1S/C15H16BrFN2/c1-18-14(9-8-11-5-2-3-10-19-11)12-6-4-7-13(16)15(12)17/h2-7,10,14,18H,8-9H2,1H3 |
| InChIKey | FBVVWAUHFHXOMR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |