C12H10Br2FNS — CID 106647686
1-(3-bromo-2-fluorophenyl)-1-(5-bromothiophen-3-yl)-N-methylmethanamine (PubChem CID 106647686) has the molecular formula C12H10Br2FNS and a molecular weight of 379.09 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)-1-(5-bromothiophen-3-yl)-N-methylmethanamine.
| Compound Name | 1-(3-bromo-2-fluorophenyl)-1-(5-bromothiophen-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106647686 |
| Molecular Formula | C12H10Br2FNS |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 376.89 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)-1-(5-bromothiophen-3-yl)-N-methylmethanamine |
| SMILES | CNC(c1csc(Br)c1)c1cccc(Br)c1F |
| InChI | InChI=1S/C12H10Br2FNS/c1-16-12(7-5-10(14)17-6-7)8-3-2-4-9(13)11(8)15/h2-6,12,16H,1H3 |
| InChIKey | GCTUQLRISJUJTP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |