C16H24N2 — CID 106648848
[1-(cyclohexen-1-yl)-2-methyl-2-phenylpropyl]hydrazine (PubChem CID 106648848) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is [1-(cyclohexen-1-yl)-2-methyl-2-phenylpropyl]hydrazine.
| Compound Name | [1-(cyclohexen-1-yl)-2-methyl-2-phenylpropyl]hydrazine |
|---|---|
| PubChem CID | 106648848 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | [1-(cyclohexen-1-yl)-2-methyl-2-phenylpropyl]hydrazine |
| SMILES | CC(C)(c1ccccc1)C(NN)C1=CCCCC1 |
| InChI | InChI=1S/C16H24N2/c1-16(2,14-11-7-4-8-12-14)15(18-17)13-9-5-3-6-10-13/h4,7-9,11-12,15,18H,3,5-6,10,17H2,1-2H3 |
| InChIKey | QOKQFYKVMXZLFA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|