C12H25N3 — CID 106649237
2-(cycloocten-1-yl)-2-hydrazinyl-N,N-dimethylethanamine (PubChem CID 106649237) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-(cycloocten-1-yl)-2-hydrazinyl-N,N-dimethylethanamine.
| Compound Name | 2-(cycloocten-1-yl)-2-hydrazinyl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 106649237 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 2-(cycloocten-1-yl)-2-hydrazinyl-N,N-dimethylethanamine |
| SMILES | CN(C)CC(NN)C1=CCCCCCC1 |
| InChI | InChI=1S/C12H25N3/c1-15(2)10-12(14-13)11-8-6-4-3-5-7-9-11/h8,12,14H,3-7,9-10,13H2,1-2H3 |
| InChIKey | QAIXJFZROZBGJL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|