C16H23NO5S — CID 10664945
tert-butyl N-[5-(benzenesulfonyl)-4-oxopentyl]carbamate (PubChem CID 10664945) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is tert-butyl N-[5-(benzenesulfonyl)-4-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-(benzenesulfonyl)-4-oxopentyl]carbamate |
|---|---|
| PubChem CID | 10664945 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | tert-butyl N-[5-(benzenesulfonyl)-4-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO5S/c1-16(2,3)22-15(19)17-11-7-8-13(18)12-23(20,21)14-9-5-4-6-10-14/h4-6,9-10H,7-8,11-12H2,1-3H3,(H,17,19) |
| InChIKey | MMWYQIVLNUMOFR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|